
CAS 15790-94-0: trans-2-Undecenoic acid
Formula:C11H20O2
InChI:InChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h9-10H,2-8H2,1H3,(H,12,13)/b10-9+
InChI key:InChIKey=IGBBVTAVILYDIO-MDZDMXLPSA-N
SMILES:C(CCCCCC)C/C=C/C(O)=O
Synonyms:- (2E)-2-Undecenoic acid
- (2E)-undec-2-enoic acid
- (E)-2-Undecenoic acid
- 2-Undecenoic acid, (2E)-
- 2-Undecenoic acid, (E)-
- 2-trans-Undecenoic acid
- trans-2-Undecenoic acid
Sort by
Found 6 products.
Trans-2-undecenoic acid
CAS:Trans-2-undecenoic acid is a synthetic compound, which is primarily derived from the unsaturated fatty acids found in various plant oils. It exhibits a unique molecular structure featuring a double bond configuration that imparts specific chemical properties, making the compound versatile for scientific applications. This unsaturated organic acid acts primarily through its antimicrobial properties. By disrupting the lipid membranes of microorganisms, trans-2-undecenoic acid inhibits their growth and proliferation, showing efficacy against a range of bacteria and fungi. This mode of action renders it a valuable tool in the development of antimicrobial agents. In scientific research, trans-2-undecenoic acid is employed in the formulation of antimicrobial coatings, contributing to the development of safe surfaces in clinical settings. Additionally, it is utilized in the synthesis of complex organic molecules, serving as an intermediate in various chemical reactions. Research into its broader applications continues, as scientists seek to further harness its biochemical potential for industrial and pharmaceutical use.Formula:C11H20O2Purity:Min. 95%Molecular weight:184.27 g/moltrans-2-Undecenoic acid
CAS:trans-2-Undecenoic acid ((E)-Undec-2-enoic acid) ((E)-2-Undecenoic acid) is an α,β-unsaturated carboxylic acid and is characterized by acid dimers.Formula:C11H20O2Purity:99.56%Color and Shape:SolidMolecular weight:184.28