
CAS 15802-80-9: 3-(1,1-Dimethylethyl)-1H-pyrazole
Formula:C7H12N2
InChI:InChI=1S/C7H12N2/c1-7(2,3)6-4-5-8-9-6/h4-5H,1-3H3,(H,8,9)
InChI key:InChIKey=YIDCITOHTLPMMZ-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1C=CNN1
Synonyms:- 1H-pyrazole, 3-(1,1-dimethylethyl)-
- 1H-pyrazole, 5-(1,1-dimethylethyl)-
- 3-(1,1-Dimethylethyl)-1H-pyrazole
- 3-tert-Butylpyrazole
- 5-tert-butyl-1H-pyrazole
- Pyrazole, 3-tert-butyl-
- 3-tert-Butyl-1H-pyrazole
- 3-tert-Butyl-1H-pyrazole
Sort by
Found 4 products.
1H-Pyrazole, 3-(1,1-dimethylethyl)-
CAS:Formula:C7H12N2Purity:97%Color and Shape:SolidMolecular weight:124.18363-tert-butyl-1H-pyrazole
CAS:Purity:95.0%Color and Shape:Solid, CrystallineMolecular weight:124.186996459960943-tert-Butyl-1H-pyrazole
CAS:3-tert-Butyl-1H-pyrazole is a pyrazole compound that has been shown to be an irreversible oxidant. It reacts with electron donors such as methylene blue, generating a reactive radical. This reactive radical can then bind to an electron acceptor such as silver ions, causing the oxidation of the silver ions and the formation of a silver complex. 3-tert-Butyl-1H-pyrazole has been used to study the coordination chemistry of metal ions. It has also shown potent antagonist activity in models systems for tyrosinase, which is involved in melanin synthesis. The covalent bond between 3-tert-butyl-1H-pyrazole and tyrosinase occurs through hydrogen bonding, which provides more stability than other types of bonds, such as ionic or van der Waals interactions.Formula:C7H12N2Purity:Min. 95%Molecular weight:124.18 g/mol