
CAS 16034-48-3: 2-(1H-Pyrazol-1-yl)acetic acid
Formula:C5H6N2O2
InChI:InChI=1/C5H6N2O2/c8-5(9)4-7-3-1-2-6-7/h1-3H,4H2,(H,8,9)
SMILES:c1cnn(c1)CC(=O)O
Synonyms:- 1H-Pyrazol-1-ylacetic acid
- 1H-Pyrazole-1-acetic acid
Sort by
Found 4 products.
1H-Pyrazole-1-acetic acid
CAS:Formula:C5H6N2O2Purity:95%Color and Shape:SolidMolecular weight:126.11331H-Pyrazol-1-ylacetic acid
CAS:1H-Pyrazol-1-ylacetic acid is a coordination compound that contains two carboxylate anions and a ligand. The ligands in this molecule are the nitrogen atom, which is coordinated to three metal cations, and the oxygen atom, which coordinates with two metal cations. The coordination chemistry of 1H-pyrazole-1-ylacetic acid has been studied extensively because of its relevance to biological systems. Spectroscopic analyses have shown that the ionic form of this molecule exhibits strong absorption bands in the infrared region as well as visible light. Crystal x-ray diffraction studies have led to the determination of the crystallographic structures of 1H-pyrazole-1-ylacetic acid in both coordination and anion forms.Formula:C5H6N2O2Purity:Min. 95%Molecular weight:126.11 g/mol