
CAS 1621-56-3: 7-Methoxyisoflavone
Formula:C16H12O3
InChI:InChI=1S/C16H12O3/c1-18-12-7-8-13-15(9-12)19-10-14(16(13)17)11-5-3-2-4-6-11/h2-10H,1H3
InChI key:InChIKey=IECSQLKWZBEUGA-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(OC)=CC2)OC=C1C3=CC=CC=C3
Synonyms:- 3-Phenyl-7-methoxy-4H-1-benzopyran-4-one
- 4H-1-benzopyran-4-one, 7-methoxy-3-phenyl-
- 7-Methoxy Isoflavone
- 7-Methoxy-3-phenyl-4H-1-benzopyran-4-one
- 7-Methoxyisoflavone
- Aurora 15641
- Isoflavone, 7-methoxy-
- 7-Methoxy-3-phenyl-4H-chromen-4-one
Sort by
Found 4 products.
4H-1-Benzopyran-4-one, 7-methoxy-3-phenyl-
CAS:Formula:C16H12O3Purity:98%Color and Shape:SolidMolecular weight:252.26477-Methoxyisoflavone
CAS:7-Methoxyisoflavone is a synthetic isoflavone, which is a type of flavonoid compound typically found in plants. This compound, however, is artificially synthesized in laboratories, differentiating it from naturally occurring isoflavones found in sources like soy and other legumes. Its structure allows it to act as a non-hormonal anabolic agent, meaning it purportedly enhances anabolic processes without directly interacting with hormonal pathways, such as those involving testosterone or other steroids. The primary action of 7-Methoxyisoflavone is believed to involve the modulation of cellular signaling pathways that promote protein synthesis, contributing to increased muscle growth and improved physical performance. It is thought to influence the body's ability to adapt to training by possibly enhancing nitrogen retention and muscle protein synthesis. This compound has been explored for its potential applications in sports and fitness, where it may aid in muscle building and strength enhancement. Additionally, it has attracted interest for potential benefits in reducing muscle wasting in clinical settings. Researchers continue to investigate its efficacy and safety to establish a clearer understanding of its mechanisms and potential applications.Formula:C16H12O3Purity:Min. 95%Molecular weight:252.26 g/mol7-Methoxyisoflavone
CAS:7-Methoxyisoflavone is an activator of adenosine monophosphate-activated protein kinase (AMPK).Formula:C16H12O3Purity:99.94%Color and Shape:SolidMolecular weight:252.26