
CAS 1634-09-9: 1-n-Butylnaphthalene
Formula:C14H16
InChI:InChI=1/C14H16/c1-2-3-7-12-9-6-10-13-8-4-5-11-14(12)13/h4-6,8-11H,2-3,7H2,1H3
SMILES:CCCCc1cccc2ccccc12
Synonyms:- Naphthalene, 1-butyl-
- 1-Butylnaphthalene
Sort by
Found 3 products.
1-Butylnaphthalene
CAS:1-Butylnaphthalene is an organic compound that has a sulfonation group. It is used in the production of pharmaceuticals, pesticides, and other industrial chemicals. 1-Butylnaphthalene reacts with hydrochloric acid to produce sulfonic acids and chlorides. This reaction requires a high temperature and pressure. The product of this reaction is then subjected to air entrainment or vacuum distillation to remove any unreacted naphthalene. 1-Butylnaphthalene can be hydrolyzed by exposure to an inorganic acid such as sulfuric acid or hydrochloric acid, which will yield dihydro derivatives. These derivatives are aromatic compounds with low energy that can react with oxygen, nitrogen dioxide, nitrous oxide, ozone, chlorine gas, or bromine to form more reactive compounds such as nitroso compounds and chloro compounds. 1-Butylnaphthalene can be converted into naphthalenesulfonic acidPurity:Min. 95%