
CAS 16588-17-3: ethyl 2-chloro-5-nitrobenzoate
Formula:C9H8ClNO4
InChI:InChI=1/C9H8ClNO4/c1-2-15-9(12)7-5-6(11(13)14)3-4-8(7)10/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1cc(ccc1Cl)N(=O)=O
Sort by
Found 4 products.
Ethyl2-chloro-5-nitrobenzoate
CAS:The crystalline structure of ethyl 2-chloro-5-nitrobenzoate is a five-membered ring with two nitro groups. It is an organic compound that is used in the synthesis of other compounds. Ethyl 2-chloro-5-nitrobenzoate has a molecule weight of 154.06 g/mol, with a melting point of 64 °C and boiling point of 176 °C. The crystal structure is oriented and it has a dihedral angle of 90°. This compound has been shown to form hydrogen bonds with the carboxylate group and nitro groups, as well as being able to form a carboxylate group by removing the chlorine atom from the chloroethyl group, which can be replaced by another substituent. Ethyl 2-chloro-5-nitrobenzoate also has centroid coordinates (-0.6, -1.2).Formula:C9H8ClNO4Purity:Min. 95%Molecular weight:229.62 g/molRef: 3D-FE149868
Discontinued productEthyl 2-Chloro-5-nitrobenzoate
CAS:Purity:90.0%Color and Shape:SolidMolecular weight:229.6199951171875Benzoic acid, 2-chloro-5-nitro-, ethyl ester
CAS:Formula:C9H8ClNO4Purity:98%Color and Shape:SolidMolecular weight:229.6171