
CAS 1667-04-5: Mesitylchloride; 95%
Formula:C9H11Cl
InChI:InChI=1/C9H11Cl/c1-6-4-7(2)9(10)8(3)5-6/h4-5H,1-3H3
SMILES:Cc1cc(C)c(c(C)c1)Cl
Synonyms:- Mesityl chloride
- 2-Chloro-1,3,5-Trimethylbenzene
Sort by
Found 5 products.
2-Chloro-1,3,5-Trimethylbenzene
CAS:2-Chloro-1,3,5-TrimethylbenzenePurity:98%Molecular weight:154.64g/molMesityl Chloride
CAS:Formula:C9H11ClPurity:>97.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:154.64Mesityl Chloride
CAS:Mesityl chloride is a molecule that reacts with hydroxyl groups to form an ether. It can be used as a reagent in organic synthesis, for example in the preparation of glucosylceramide. Mesityl chloride can also be used as a solvent, or it can react with halides to form esters and other derivatives. Mesityl chloride is found in some plastics and dyes, and it is also used in the manufacture of pharmaceuticals such as estrogen receptor modulators. Mesityl chloride has been shown to cause cancer by reacting with radiation from X-rays or gamma rays, which forms DNA adducts (biphenyl) that bind to DNA and prevent cell replication.Formula:C9H11ClPurity:Min. 95%Molecular weight:154.64 g/molBenzene, 2-chloro-1,3,5-trimethyl-
CAS:Formula:C9H11ClPurity:97%Color and Shape:LiquidMolecular weight:154.6366