
CAS 16726-67-3: 5-bromonaphthalene-1-carboxylic acid
Formula:C11H7BrO2
InChI:InChI=1/C11H7BrO2/c12-10-6-2-3-7-8(10)4-1-5-9(7)11(13)14/h1-6H,(H,13,14)
SMILES:c1cc2c(cccc2Br)c(c1)C(=O)O
Synonyms:- 5-Bromo-1-naphthoic acid
Sort by
Found 4 products.
5-Bromo-1-naphthoic acid
CAS:Formula:C11H7BrO2Purity:97%Color and Shape:SolidMolecular weight:251.07615-Bromo-1-naphthoic acid
CAS:5-Bromo-1-naphthoic acid (5-BNAA) is a photoactive agent that belongs to the group of anti-tumor agents. It has been shown to have a strong enhancing effect on the production of ethyl esters, which are intermediates in the biosynthesis of naphthalene. 5-BNAA can be used as an anti-cancer drug, but it also has a cytotoxic effect on blood vessels and erythrocytes. 5-BNAA blocks nucleophilic reactions by binding to DNA and RNA, thereby inhibiting protein synthesis. This drug also acts as a surfactant by increasing the surface tension of water and preventing coagulation.Formula:C11H7BrO2Purity:Min. 95%Molecular weight:251.08 g/molRef: 3D-FB33073
Discontinued product