P-(4-Bromophenyl)phosphonic acid, with the CAS number 16839-13-7, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group attached to a para-bromophenyl moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the phosphonic acid group. It exhibits acidic properties due to the protonable phosphonic acid group, which can participate in various chemical reactions, including esterification and nucleophilic substitution. The bromine substituent on the phenyl ring can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and material science. Additionally, P-(4-Bromophenyl)phosphonic acid may serve as a precursor or intermediate in the synthesis of other phosphorus-containing compounds, and its derivatives can be explored for applications in agrochemicals and pharmaceuticals. Safety data should be consulted for handling and storage, as with all chemical substances.

P-(4-Bromophenyl)phosphonic acid

16839-13-7: (4-Bromophenyl)phosphonic acid, (p-Bromophenyl)phosphonic acid, 4-Bromophenylphosphonic acid, Brn 2936778, Nsc 13558, P-(4-Bromophenyl)phosphonic acid, Phosphonic acid, (4-bromophenyl)-, Phosphonic acid, (4-bromophenyl)- (9CI), Phosphonic acid, (p-bromophenyl)-, Phosphonic acid, P-(4-bromophenyl)-, p-Bromobenzenephosphonic acid,  4-16-00-01083 (Beilstein Handbook Reference)

CAS 16839-13-7: P-(4-Bromophenyl)phosphonic acid

(4-Bromophenyl)phosphonic acid

Ref: 10-F760008

(4-Bromophenyl)phosphonic Acid

Ref: 3B-B5015

Phosphonic acid, P-(4-bromophenyl)-

Ref: IN-DA001Y1H

(4-Bromophenyl)Phosphonic Acid

Ref: 54-OR1008162