
CAS 16879-39-3: 2-Bromo-4,6-dimethylpyrimidine
Formula:C6H7BrN2
InChI:InChI=1/C6H7BrN2/c1-4-3-5(2)9-6(7)8-4/h3H,1-2H3
SMILES:Cc1cc(C)nc(Br)n1
Synonyms:- 16879-39-3
Sort by
Found 3 products.
2-Bromo-4,6-dimethylpyrimidine
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:187.03999328613282-Bromo-4,6-dimethylpyrimidine
CAS:2-Bromo-4,6-dimethylpyrimidine (2-BDMP) is a chemical compound that is synthesised by reacting acetonitrile with methylene bromide in the presence of copper. The 2-BDMP has a molecular weight of 136.22, melting point of 117°C and boiling point of 165°F. It has an ambident nature with respect to anions, which means it is soluble in water and organic solvents such as acetonitrile and tetrahydrofuran. 2-BDMP can be used as a building block for synthesising other compounds such as amidines or dioxanes. This chemical can also be used to produce yields of bromoalkyls in the presence of alkylating agents such as chloromethyl methyl ether or methanol.Formula:C6H7BrN2Purity:Min. 95%Molecular weight:187.04 g/molPyrimidine, 2-bromo-4,6-dimethyl-
CAS:Formula:C6H7BrN2Purity:98%Color and Shape:SolidMolecular weight:187.0372