
CAS 17074-02-1: Neohesperidose
Formula:C12H22O10
InChI:InChI=1S/C12H22O10/c1-4-7(16)10(19)11(20)12(21-4)22-6(3-14)9(18)8(17)5(15)2-13/h3-13,15-20H,2H2,1H3/t4-,5+,6-,7-,8+,9+,10+,11+,12-/m0/s1
InChI key:InChIKey=BQEBASLZIGFWEU-YMKBBEOCSA-N
SMILES:O([C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)C=O)[C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O1
Synonyms:- 2-O-(6-Deoxy-alpha-L-mannopyranosyl)-D-glucose
- 2-O-(6-Deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-<smallcap>D</span>-glucose
- <span class="text-smallcaps">D</smallcap>-Glucose, 2-O-(6-deoxy-α-<smallcap>L</span>-mannopyranosyl)-
- Neohesperidose
- 2-O-(6-Deoxy-α-L-mannopyranosyl)-D-glucose
- D-Glucose, 2-O-(6-deoxy-α-L-mannopyranosyl)-
Sort by
Found 4 products.
Neohesperidose
CAS:Neohesperidose is a disaccharide carbohydrate, which is naturally derived from certain citrus fruits and plants. It is primarily sourced from the hydrolysis of neohesperidin, a flavonoid glycoside commonly found in the peels of citrus fruits such as oranges and grapefruits. The mode of action of neohesperidose involves interaction with taste receptors, where it exhibits notable sweetening properties, though it is not as sweet as sucrose. Neohesperidose is used mainly in the food and beverage industry as a sweetening agent. It acts as a precursor in the synthesis of neohesperidin dihydrochalcone, a potent non-caloric sweetener known for its intense sweetness. In research, it serves as an important reference compound for the study of flavonoid biosynthesis and metabolism. Additionally, its unique interactions with taste receptors make it an intriguing subject of inquiry for further development of sweeteners that could mimic sugar without its caloric impact. Scientists study its extraction and modification to enhance its applicability in creating flavors and functional foods.Formula:C12H22O10Purity:Min. 95%Color and Shape:PowderMolecular weight:326.3 g/molNeohesperidose
CAS:Neohesperidose is a natural product isolated from species of typha.Formula:C12H22O10Purity:98%Color and Shape:SolidMolecular weight:326.3