![4-[4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]-6-ethylbenzene-1,3-diol](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F311543-4-4-23-dihydro-14-benzodioxin-6-yl-5-methyl-1h-pyrazol-3-yl-6-ethyl-13-benzenediol.webp&w=3840&q=75)
CAS 171009-07-7: 4-[4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]-6-ethylbenzene-1,3-diol
Formula:C20H20N2O4
InChI:InChI=1S/C20H20N2O4/c1-3-12-8-14(16(24)10-15(12)23)20-19(11(2)21-22-20)13-4-5-17-18(9-13)26-7-6-25-17/h4-5,8-10,23-24H,3,6-7H2,1-2H3,(H,21,22)
InChI key:InChIKey=OWPMENVYXDJDOW-UHFFFAOYSA-N
SMILES:CC1=C(C(=NN1)C2=CC(CC)=C(O)C=C2O)C=3C=C4C(=CC3)OCCO4
Synonyms:- 1,3-Benzenediol, 4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]-6-ethyl-
- 4-[4-(2,3-Dihydro-1,4-Benzodioxin-6-Yl)-3-Methyl-1H-Pyrazol-5-Yl]-6-Ethylbenzene-1,3-Diol
- 4-[4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]-6-ethyl-1,3-benzenediol
- Cct 018159
- Cct018159
Sort by
Found 4 products.
HSP90 Inhibitor, CCT018159
CAS:HSP90 Inhibitor, CCT018159, is a synthetic chemical compound which targets HSP90, a molecular chaperone involved in the proper folding of proteins. This inhibitor is designed and synthesized through chemical methods based on structure-activity relationship studies. It operates by binding to the ATP-binding domain of HSP90, thereby inhibiting its function. This disruption in HSP90 activity leads to the degradation of client proteins that are crucial for cancer cell survival and proliferation. In scientific research, CCT018159 is primarily used to probe the role of HSP90 in various cellular processes, particularly in oncology research. Its efficacy in destabilizing several oncogenic client proteins makes it a valuable tool for studying cancer biology and understanding the complexities of protein homeostasis within malignant cells. Additionally, this inhibitor serves as a precursor or lead compound for the development of more potent and selective HSP90 inhibitors, facilitating advances in therapeutic strategies against cancers where HSP90 client proteins play a critical role. Researchers utilize CCT018159 to delineate signaling pathways and explore potential vulnerabilities in various cancer types, contributing to the broader field of targeted cancer therapy development.Formula:C20H20N2O4Purity:Min. 95%Molecular weight:352.38 g/molCCT018159
CAS:CCT018159: ATP-competitive HSP90 inhibitor, IC50 3.2 μM (human), 6.6 μM (yeast), blocks invasion, angiogenesis, induces G1 arrest and apoptosis.Formula:C20H20N2O4Purity:98.78%Color and Shape:SolidMolecular weight:352.38