
CAS 171047-01-1: 3-(3-Hydroxyphenyl)benzoic acid
Formula:C13H10O3
InChI:InChI=1/C13H10O3/c14-12-6-2-4-10(8-12)9-3-1-5-11(7-9)13(15)16/h1-8,14H,(H,15,16)
SMILES:c1cc(cc(c1)C(=O)O)c1cccc(c1)O
Synonyms:- [1,1'-Biphenyl]-3-carboxylic acid, 3'-hydroxy-
- 3'-Hydroxybiphenyl-3-carboxylic acid
Sort by
Found 3 products.
3'-Hydroxy-biphenyl-3-carboxylic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:214.220001220703123-(3-Hydroxyphenyl)benzoic acid
CAS:Formula:C13H10O3Purity:97%Color and Shape:SolidMolecular weight:214.21673'-Hydroxy-biphenyl-3-carboxylic acid
CAS:3'-Hydroxy-biphenyl-3-carboxylic acid is a mitochondrial membrane depolarizing agent that has been shown to have anticancer potential in mammalian cells. It causes hypertrophy and population growth in stromal tumors and has been shown to inhibit the enzyme responsible for inflammatory pain, pancreatic cancer cell lines, and tumour cell lines. 3'-Hydroxy-biphenyl-3-carboxylic acid also interacts with viral DNA and prevents replication of the virus. 3'-Hydroxy-biphenyl-3-carboxylic acid can be conjugated to nucleosides or nucleotides, which may make it more effective as an anticancer agent than other agents.Formula:C13H10O3Purity:Min. 95%Molecular weight:214.22 g/mol