CAS 171058-18-7: 1-Decyl-3-methylimidazolium chloride
Formula:C14H27N2·Cl
InChI:InChI=1S/C14H27N2.ClH/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;/h12-14H,3-11H2,1-2H3;1H/q+1;/p-1
InChI key:InChIKey=HTZVLLVRJHAJJF-UHFFFAOYSA-M
SMILES:C(CCCCCCCCC)[N+]=1C=CN(C)C1.[Cl-]
Synonyms:- 1H-Imidazolium, 1-decyl-3-methyl-, chloride
- 1-Decyl-3-methylimidazolium chloride
- 1H-Imidazolium, 3-decyl-1-methyl-, chloride (1:1)
Sort by
Found 5 products.
1H-Imidazolium, 1-decyl-3-methyl-, chloride
CAS:Formula:C14H27ClN2Purity:96%Color and Shape:LiquidMolecular weight:258.83061-Decyl-3-methylimidazolium Chloride
CAS:Formula:C14H27ClN2Purity:>96.0%(HPLC)Color and Shape:Light yellow to Brown clear liquidMolecular weight:258.831-decyl-3-methylimidazolium chloride
CAS:Purity:96.0%Color and Shape:Liquid, No data available.Molecular weight:258.82998657226561-Decyl-3-methylimidazolium Chloride
CAS:1-Decyl-3-methylimidazolium chloride is an ionic liquid, which is a salt in the form of a liquid. It has a neutral pH and low toxicity. 1-Decyl-3-methylimidazolium chloride can be used as a synergistic agent for organic reactions and as an electrolyte for batteries. Its solubility data was determined under constant pressure at 25°C and its dry weight was obtained from titration calorimetry. The structure of 1-decyl-3-methylimidazolium chloride has been analyzed using magnetic resonance spectroscopy, proton nuclear magnetic resonance spectroscopy, and infrared spectroscopy. This compound is cationic because it has a positive charge on the end of the molecule that attracts water molecules to form hydrogen bonds. It also has benzalkonium chloride as an anion, which stabilizes the ionic liquid by forming hydrogen bonds with other moleculesFormula:C14H27ClN2Purity:Min. 95%Molecular weight:258.83 g/molRef: 3D-WGA05818
Discontinued product1-decyl-3-methylimidazolium chloride
CAS:1-decyl-3-methylimidazolium chloridePurity:99%Molecular weight:258.84g/mol
