
CAS 17151-47-2: tributyl(4-fluorophenyl)stannane
Formula:C18H31FSn
InChI:InChI=1/C6H4F.3C4H9.Sn/c7-6-4-2-1-3-5-6;3*1-3-4-2;/h2-5H;3*1,3-4H2,2H3;/rC18H31FSn/c1-4-7-14-20(15-8-5-2,16-9-6-3)18-12-10-17(19)11-13-18/h10-13H,4-9,14-16H2,1-3H3
SMILES:CCCC[Sn](CCCC)(CCCC)c1ccc(cc1)F
Sort by
Found 2 products.
Tributyl(4-fluorophenyl)stannane
CAS:Controlled ProductTributyl (4-fluorophenyl)stannane is a model system for the study of electrochemical properties. It is a synthetic compound that has been studied by means of both quantum mechanical calculations and experimental measurements. The electronic structure of tributyl (4-fluorophenyl)stannane in nature has been rationalized using the functional theory. The time-dependent theory has also been used to help explain cyclic phenomena, such as catalysis, by considering moieties and photophysical transitions. Tributyl (4-fluorophenyl)stannane is homoleptic, meaning it has the same number of electrons on each atom. This makes it easier to predict how tributyl (4-fluorophenyl)stannane will react with other molecules because all its bonds are identical.Formula:C18H31FSnPurity:Min. 95%Molecular weight:385.15 g/mol1-Fluoro-4-(tributylstannyl)benzene
CAS:1-Fluoro-4-(tributylstannyl)benzeneFormula:C18H31FSnPurity:90+%Color and Shape: clear. colourless liquidMolecular weight:385.15g/mol