
CAS 17151-48-3: Tributyl(4-chlorophenyl)stannane
Formula:C18H31ClSn
InChI:InChI=1S/C6H4Cl.3C4H9.Sn/c7-6-4-2-1-3-5-6;3*1-3-4-2;/h2-5H;3*1,3-4H2,2H3;
InChI key:InChIKey=GZJNLVYEAQGOSJ-UHFFFAOYSA-N
SMILES:[Sn](CCCC)(CCCC)(CCCC)C1=CC=C(Cl)C=C1
Synonyms:- Stannane, tributyl(4-chlorophenyl)-
- Tributyl(p-chlorophenyl)tin
- Tin, tributyl(p-chlorophenyl)-
- Tributyl(4-chlorophenyl)stannane
- Stannane, tributyl(p-chlorophenyl)-
Sort by
Found 2 products.
Tributyl-(4-chloro-phenyl)-stannane
CAS:Controlled ProductTributyl-(4-chloro-phenyl)-stannane is a chlorinating agent that can be used to introduce chlorine into organic compounds. Tributyl-(4-chloro-phenyl)-stannane reacts with tosylate and chloramine-T to form benzene derivatives. It is a nucleophilic reagent, which means it has the ability to attack the electron pair in an atom or molecule of an electrophile, such as hydroxide ion. When tributyl-(4-chloro-phenyl)-stannane reacts with hydroxide ion, the chloride is replaced by hydrogen, forming tributyltin hydride and hydrochloric acid. Tributyl-(4-chloro-phenyl)-stannane is radioactive because it contains a radioactive isotope of chlorine. The isotope has been found in three forms: 35Cl (99%), 37Cl (0.3%), and 38Cl (0.Purity:Min. 95%1-Chloro-4-(tributylstannyl)benzene
CAS:1-Chloro-4-(tributylstannyl)benzeneMolecular weight:401.60g/mol