CAS 17213-57-9: 3,5-Dimethoxybenzoyl chloride
Formula:C9H9ClO3
InChI:InChI=1S/C9H9ClO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3
InChI key:InChIKey=FTHPLWDYWAKYCY-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=CC(OC)=CC(OC)=C1
Synonyms:- 3,5-Methoxybenzoyl chloride
- Benzoyl chloride, 3,5-dimethoxy-
- NSC 156082
- 3,5-Dimethoxybenzoyl chloride
- 3,5-Dimethoxybenzoic acid chloride
Sort by
Found 6 products.
3,5-Dimethoxybenzoyl Chloride
CAS:3,5-Dimethoxybenzoyl ChloridePurity:98%Molecular weight:200.62g/mol3,5-Dimethoxybenzoyl chloride
CAS:Purity:98.0%Color and Shape:LiquidMolecular weight:200.61999511718753,5-Dimethoxybenzoyl Chloride
CAS:Controlled ProductFormula:C9H9ClO3Color and Shape:NeatMolecular weight:200.623,5-DIMETHOXYBENZOYL CHLORIDE
CAS:Formula:C9H9ClO3Purity:98%Color and Shape:SolidMolecular weight:200.6193,5-Dimethoxybenzoyl Chloride
CAS:Formula:C9H9ClO3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to lumpMolecular weight:200.623,5-Dimethoxybenzoyl Chloride
CAS:3,5-Dimethoxybenzoyl Chloride is an antiproliferative agent that has been shown to have a potent antiproliferative effect in vitro. It has been shown to inhibit the growth of bacterial cells by inhibiting their DNA synthesis, leading to cellular apoptosis. 3,5-Dimethoxybenzoyl Chloride inhibits DNA synthesis by binding to the enzyme DNA gyrase and preventing it from unwinding circular DNA molecules. This compound also inhibits protein synthesis in bacteria by binding to the enzyme ribosome. Triflates are used as starting materials for the synthesis of 3,5-dimethoxybenzoyl chloride. Aldoximes are synthesized from organic solvents and l-norvaline in the presence of a catalyst such as potassium tert-butoxide or sodium tert-butoxide. An anti-inflammatory product can be obtained from antrodia camphorata mushrooms.Purity:Min. 95%Ref: 3D-FD61763
Discontinued product
