
CAS 1722-11-8: 1-(6-Chloro-pyridazino-3-yl)piperidine
Formula:C9H12ClN3
InChI:InChI=1/C9H12ClN3/c10-8-4-5-9(12-11-8)13-6-2-1-3-7-13/h4-5H,1-3,6-7H2
SMILES:C1CCN(CC1)c1ccc(Cl)nn1
Synonyms:- 3-Chloro-6-Piperidin-1-Ylpyridazine Hydrochloride
- 3-Chloro-6-piperidin-1-yl-pyridazine
Sort by
Found 4 products.
3-Chloro-6-(1-piperidinyl)pyridazine
CAS:3-Chloro-6-(1-piperidinyl)pyridazine is a coordination complex that is immobilized on zeolites. It can be used to remove ionic contaminants from wastewater by exchanging them for the metal ions in the coordination complex. 3-Chloro-6-(1-piperidinyl)pyridazine is also catalytic and can be used for liquid phase reactions. This ligand has been shown to have a cyclic structure and it has been modified with various substituents to change its properties, such as viscosity.Formula:C9H12ClN3Purity:Min. 95%Molecular weight:197.66 g/molRef: 3D-FC53919
Discontinued product1-(6-Chloro-pyridazino-3-yl)piperidine
CAS:Formula:C9H12ClN3Purity:98%Color and Shape:SolidMolecular weight:197.66473-Chloro-6-(piperidin-1-yl)pyridazine
CAS:3-Chloro-6-(piperidin-1-yl)pyridazinePurity:98%Molecular weight:197.66g/mol