CAS 1722-26-5: triethylamine-borane
Formula:C6H18BN
InChI:InChI=1S/C6H18BN/c1-4-8(7,5-2)6-3/h4-6H2,1-3,7H3
InChI key:InChIKey=ONRDAGWFOUZNLV-UHFFFAOYSA-N
SMILES:[N]([B+3]([H-])([H-])[H-])(CC)(CC)CC
Synonyms:- (N,N-diethylethanamine)(trihydrido)boron
- (T-4)-(N,N-Diethylethanamine)trihydroboron
- (Triethylazaniumyl)boranuide
- Borane Triethylamine
- Borane adduct with triethylamine (1:1)
- Borane complex with triethylamine (1:1)
- Borane, compd. with N,N-diethylethanamine (1:1)
- Borane, compd. with triethylamine (1:1)
- Borane-triethylamine complex
- Borazane, N,N,N-triethyl-
- Boron, (N,N-diethylethanamine)trihydro-, (T-4)-
- See more synonyms
Sort by
Found 5 products.
CALLERY™ Triethylamine borane, min. 95%
CAS:Formula:(C2H5)3NBH3Purity:min. 95%Color and Shape:colorless to amber liq.Molecular weight:115.03Borane triethylamine complex
CAS:Borane triethylamine complex is a reactive intermediate that can be used to form polymers. It can be activated by radiation or by heating, and is then able to react with various organic compounds in the presence of a catalyst. Borane triethylamine complex is used to reduce carbonyl groups in organic solvents, such as polyvinylchloride (PVC). The reduction reaction involves the transfer of electron from borane triethylamine complex to the carbonyl group, which results in the formation of an alcohol. Borane triethylamine complex has also been shown to have antiviral properties due to its ability to inhibit viral DNA synthesis.Purity:Min. 95%Borane triethylamine complex
CAS:Formula:C6H18BNPurity:98%Color and Shape:LiquidMolecular weight:115.02481999999999Triethylamine Borane
CAS:Formula:C6H15N·BH3Purity:>90.0%(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:115.03Borane triethylamine complex
CAS:Borane triethylamine complexFormula:·BH3·(C2H5)3NPurity:90%Color and Shape: clear. almost colourless liquidMolecular weight:115.02g/mol
