
CAS 17331-53-2: Thymidine, 3′-benzoate
Formula:C17H18N2O6
InChI:InChI=1S/C17H18N2O6/c1-10-8-19(17(23)18-15(10)21)14-7-12(13(9-20)24-14)25-16(22)11-5-3-2-4-6-11/h2-6,8,12-14,20H,7,9H2,1H3,(H,18,21,23)/t12-,13+,14+/m0/s1
InChI key:InChIKey=CZRPYTUJUAJMJJ-BFHYXJOUSA-N
SMILES:O=C1N([C@H]2C[C@H](OC(=O)C3=CC=CC=C3)[C@@H](CO)O2)C=C(C)C(=O)N1
Synonyms:- 1-[(4xi)-3-O-benzoyl-2-deoxy-beta-D-glycero-pentofuranosyl]-5-methylpyrimidine-2,4(1H,3H)-dione
- 3′-O-Benzoylthymidine
- Thymidine 3'-benzoate
- Thymidine, 3′-benzoate
Sort by
Found 2 products.
3'-O-Benzoylthymidine
CAS:3'-O-Benzoylthymidine is a nucleoside that is used in the synthesis of DNA. It is a monomeric compound that contains two deoxyribose sugars and one deoxyribonucleotide. 3'-O-Benzoylthymidine interacts with the phosphite triester, which stabilizes the nucleobase. This reaction leads to the formation of a glycosidic bond between the phosphate group and the 5' carbon atom in the sugar ring of 3'-O-benzoylthymidine. The chloride ion is then added to form an intermediate compound with a reactive electrophilic carbon center that can be used for subsequent reactions with other compounds or nucleobases. 3'-O-Benzoylthymidine can also be conjugated to other compounds through covalent bonds, such as phosphonates, to form more complex molecules.Formula:C17H18N2O6Purity:Min. 95%Color and Shape:PowderMolecular weight:346.34 g/mol