![2,3,4,5-Tetrahydrobenzo[f][1,4]oxazepine](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F98174-2345-tetrahydrobenzo-f-14-oxazepine.webp&w=3840&q=75)
CAS 17775-01-8: 2,3,4,5-Tetrahydrobenzo[f][1,4]oxazepine
Formula:C9H11NO
InChI:InChI=1/C9H11NO/c1-2-4-9-8(3-1)7-10-5-6-11-9/h1-4,10H,5-7H2
SMILES:c1ccc2c(c1)CNCCO2
Synonyms:- 1,4-Benzoxazepine, 2,3,4,5-Tetrahydro-
- 2,3,4,5-Tetrahydro-1,4-Benzoxazepine
Sort by
Found 3 products.
3,4-Dihydro-2H-benzo[f][1,4]oxazepine
CAS:3,4-Dihydro-2H-benzo[f][1,4]oxazepine is a natural product that belongs to the group of amides. It has been shown to bind to the responsive element, which is a sequence of nucleotides that regulates gene transcription. This binding can lead to increased synthesis of proteins and hormones. 3,4-Dihydro-2H-benzo[f][1,4]oxazepine has been shown to have affinity for bromodomains and may be able to inhibit protein-protein interactions in certain cases. Bromodomains are protein domains that interact with specific chemical groups such as amines or hormones. 3,4-Dihydro-2H-benzo[f][1,4]oxazepine also inhibits cellular growth by inducing apoptosis through nitric oxide (NO) production from methyl esters.Formula:C9H11NOPurity:Min. 95%Molecular weight:149.19 g/mol2,3,4,5-Tetrahydrobenzo[f][1,4]oxazepine
CAS:Purity:95.0%Color and Shape:LiquidMolecular weight:149.19299316406251,4-Benzoxazepine, 2,3,4,5-tetrahydro-
CAS:Formula:C9H11NOPurity:97%Color and Shape:LiquidMolecular weight:149.1897