
CAS 17939-31-0: CALIFORNIDINE PERCHLORATE
Formula:C18H28O2
InChI:InChI=1/C18H28O2/c1-3-4-5-6-7-8-9-10-15-20-18-13-11-17(12-14-18)16(2)19/h11-14H,3-10,15H2,1-2H3
SMILES:CCCCCCCCCCOc1ccc(cc1)C(=O)C
Synonyms:- 1-[4-(Decyloxy)Phenyl]Ethan-1-One
- 1-[4-(Decyloxy)phenyl]ethanone
- Ethanone, 1-(4-decyloxyphenyl)-
- Ethanone, 1-[4-(Decyloxy)Phenyl]-
Sort by
Found 3 products.
Californidine perchlorate
CAS:Natural alkaloidFormula:C20H20NO4ClO4Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:437.83Californidine perchlorate
CAS:Californidine perchlorate is a chemical compound derived from natural alkaloids, which is obtained from certain plant species known for their bioactive properties. The source of this compound is primarily rooted in botanical studies that focus on the extraction and modification of alkaloids to enhance their chemical stability and efficacy. Californidine perchlorate acts by interacting with specific biological pathways, potentially modulating enzymatic activity or receptor interactions to produce therapeutic effects. The uses and applications of californidine perchlorate are primarily in the research and development of novel pharmacological agents. Scientists are exploring its potential in various therapeutic areas, investigating its effect on cellular processes and its ability to modulate biochemical pathways in disease models. This compound may offer insights into the development of medications targeting neurological conditions, cardiovascular health, or other areas where regulation of biological signaling is critical. Ongoing studies continue to unravel its mechanisms, aiming to harness its properties for clinical benefit and understanding its safety profile.Formula:C20H20NO4·ClO4Purity:Min. 95%Molecular weight:437.83 g/molCalifornidine Perchlorate
CAS:Controlled ProductFormula:C20H20NO4·ClO4Color and Shape:NeatMolecular weight:437.828