
CAS 18035-33-1: 6-Phenylhexyltrichlorosilane
Formula:C12H17Cl3Si
InChI:InChI=1/C12H17Cl3Si/c13-16(14,15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2
SMILES:C(CCC[Si](Cl)(Cl)Cl)CCc1ccccc1
Synonyms:- Trichloro(6-Phenylhexyl)Silane
Sort by
Found 4 products.
6-Phenylhexyltrichlorosilane
CAS:Purity:>98.0%(GC)Color and Shape:Liquid, ClearMolecular weight:295.70001220703125Trichloro(6-phenylhexyl)silane
CAS:Formula:C12H17Cl3SiPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:295.70Trichloro(6-phenylhexyl)silane
CAS:Trichloro(6-phenylhexyl)silane is a silicon-based molecule that has the potential to be used in semiconducting devices. The molecule consists of three chlorine atoms and six phenyl groups, which are connected by hydrogen bonds. Trichloro(6-phenylhexyl)silane can be synthesized by reacting hexamethyldisilazane with carbon tetrachloride and then reacting the resulting product with hexachlorodisilane. The molecule is a multilayer that exhibits two different phases. In one phase, the molecules are close together and form monolayers on a surface. In the other phase, the molecules are further apart and form bilayers on a surface. Multilayer structures such as this have been shown to have high kinetic energy, while also being able to exhibit morphology and device properties that are dependent on temperatures.Formula:C12H17Cl3SiPurity:Min. 95%Molecular weight:295.71 g/molBenzene, [6-(trichlorosilyl)hexyl]-
CAS:Formula:C12H17Cl3SiPurity:98%Color and Shape:LiquidMolecular weight:295.7079