
CAS 18113-07-0: 4-Chloro-3-methoxyphenol
Formula:C7H7ClO2
InChI:InChI=1S/C7H7ClO2/c1-10-7-4-5(9)2-3-6(7)8/h2-4,9H,1H3
InChI key:InChIKey=NKFRBXPBRPYULV-UHFFFAOYSA-N
SMILES:O(C)C1=C(Cl)C=CC(O)=C1
Synonyms:- 4-Chloro-3-Methoxyphenol
- Phenol, 4-chloro-3-methoxy-
Sort by
Found 4 products.
4-Chloro-3-methoxyphenol
CAS:4-Chloro-3-methoxyphenolFormula:C7H7ClO2Purity:95%Color and Shape: faint red crystalline powderMolecular weight:158.58g/molPhenol, 4-chloro-3-methoxy-
CAS:Formula:C7H7ClO2Purity:95%Color and Shape:SolidMolecular weight:158.58234-Chloro-3-methoxy phenol
CAS:4-Chloro-3-methoxy phenol is a chemical that belongs to the group of halogenated aromatic compounds. It is a colorless liquid with a sweet odor. 4-Chloro-3-methoxy phenol has been found to be absorbed by humans through inhalation and ingestion. The absorbed dose is dependent on the individual's weight, and the radiation dose depends on the type of radiation used. 4-Chloro-3-methoxy phenol can be synthesized by reacting 2 chloroanisole with chlorine gas in an experimental reaction mechanism. This compound reacts with DNA bases and causes mutations, as well as producing reactive oxygen species that can cause oxidative damage to DNA.Formula:C7H7CIO2Purity:Min. 95%Molecular weight:158.58 g/mol