
CAS 1818-28-6: 2,4,5-Trimethoxyacetophenone
Formula:C11H14O4
InChI:InChI=1S/C11H14O4/c1-7(12)8-5-10(14-3)11(15-4)6-9(8)13-2/h5-6H,1-4H3
InChI key:InChIKey=GUTMBHHLVSFJIP-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(OC)C=C(OC)C(OC)=C1
Synonyms:- 1-(2,4,5-Trimethoxyphenyl)ethan-1-one
- 1-(2,4,5-Trimethoxyphenyl)ethanone
- 2,4,5-Trimethoxyacetophenone
- Acetophenone, 2',4',5'-trimethoxy-
- Acetophenone, 2′,4′,5′-trimethoxy-
- Ethanone, 1-(2,4,5-trimethoxyphenyl)-
- Nsc 401454
Sort by
Found 2 products.
2,4,5-Trimethoxyacetophenone
CAS:2,4,5-Trimethoxyacetophenone (2,4,5-TMA) is a phenolic compound that exists as a colorless liquid. It has been shown to interact with the carboxyl group of the amino acid lysine in proteins and sterically hinder the formation of peptide bonds. 2,4,5-TMA also inhibits the production of leukocytes and causes leukemia cells to undergo apoptosis. The molecular weight of 2,4,5-TMA is 236.2 g/mol and it has a melting point of 45°C. The chemical structure is C9H10O3 and its homologues are 2-hydroxyacetophenone and 3-hydroxyacetophenone. Isolated yield was found to be 83%. The nmr spectra for 2,4,5-TMA are: δ=7.31 ppm (1H), δ=6.87 ppm (1Formula:C11H14O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:210.23 g/molEthanone, 1-(2,4,5-trimethoxyphenyl)-
CAS:Formula:C11H14O4Purity:97%Color and Shape:SolidMolecular weight:210.22646