
CAS 1821908-49-9: Propanamide, 2-amino-N-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]-, hydrochloride (1:1), (2S)-
Formula:C19H24N2O2·ClH
InChI:InChI=1S/C19H24N2O2.ClH/c1-12-7-13(2)9-17(8-12)23-18-6-5-16(10-14(18)3)11-21-19(22)15(4)20;/h5-10,15H,11,20H2,1-4H3,(H,21,22);1H/t15-;/m0./s1
InChI key:InChIKey=OQGSBQJSJRLNQH-RSAXXLAASA-N
SMILES:O(C1=CC(C)=CC(C)=C1)C2=C(C)C=C(CNC([C@H](C)N)=O)C=C2.Cl
Synonyms:- Propanamide, 2-amino-N-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]-, hydrochloride (1:1), (2S)-
Sort by
Found 3 products.
SGC2085 Hydrochloride
CAS:SGC2085 Hydrochloride is a selective inhibitor, which is a chemically synthesized compound designed to specifically target and inhibit certain biological processes. This inhibitor is derived from small molecule chemical synthesis and acts by selectively binding to its target, thereby modulating its biological activity. The primary mode of action of SGC2085 Hydrochloride involves the inhibition of a specific protein or enzyme, interfering with its normal activity or function. This targeted approach allows scientists to study specific pathways and mechanisms within complex biological systems, thereby elucidating their roles in cellular processes. SGC2085 Hydrochloride is primarily used in scientific research, particularly within the fields of biochemistry and pharmacology, to explore the effects of specific protein inhibition on cellular functions. It may serve as a valuable tool in drug discovery and development, providing insights into potential therapeutic targets and the mechanisms of action of new drugs. Researchers utilize SGC2085 Hydrochloride to conduct preclinical studies, aiming to understand disease mechanisms and identify novel therapeutic strategies.Formula:C19H24N2O2•HClPurity:Min. 95%Molecular weight:312.41 g/molSGC2085 HCl
CAS:SGC2085: potent, selective CARM1 inhibitor; IC50=50 nM; >100x selectivity vs other PRMTs; impacts cancer growth.Formula:C19H24N2O2·HClPurity:99.91%Color and Shape:SolidMolecular weight:348.87Ref: TM-T4013
1mg93.00€2mg150.00€5mg190.00€10mg343.00€25mg567.00€50mg825.00€100mg1,130.00€1mL*10mM (DMSO)244.00€