
CAS 18233-24-4: (6E)-6-(5-phenyl-1,3,4-oxadiazol-2(3H)-ylidene)cyclohexa-2,4-dien-1-one
Formula:C14H10N2O2
InChI:InChI=1/C14H10N2O2/c17-12-9-5-4-8-11(12)14-16-15-13(18-14)10-6-2-1-3-7-10/h1-9,16H/b14-11+
Sort by
Found 2 products.
2-(5-Phenyl-1,3,4-oxadiazol-2-yl)phenol
CAS:2-(5-Phenyl-1,3,4-oxadiazol-2-yl)phenol is a chemosensor that has low efficiency and coordination chemistry. It has been shown to have bathochromic and hypsochromic properties. The ligand of 2-(5-Phenyl-1,3,4-oxadiazol-2-yl)phenol is an anion. This ligand is able to form a complex with metal ions such as Cu(II), Fe(II), and Mn(II). The optical properties of 2-(5-Phenyl-1,3,4-oxadiazol-2-yl)phenol can be altered by the addition of hydroxy groups or protonation.Formula:C14H10N2O2Purity:Min. 95%Molecular weight:238.24 g/molRef: 3D-FP116851
Discontinued product