CAS 18456-03-6: (-)-Bakkenolide D
Formula:C21H28O6S
InChI:InChI=1S/C21H28O6S/c1-12-6-7-15(27-16(23)8-9-28-5)17-18(26-14(3)22)21(11-20(12,17)4)13(2)10-25-19(21)24/h8-9,12,15,17-18H,2,6-7,10-11H2,1,3-5H3/b9-8-/t12-,15-,17+,18+,20+,21+/m0/s1
InChI key:InChIKey=LWHLMCCRIWZBQO-PDSBHGERSA-N
SMILES:O(C(C)=O)[C@H]1[C@@]2(C[C@@]3(C)[C@@]1([C@@H](OC(/C=C\SC)=O)CC[C@@H]3C)[H])C(=C)COC2=O
Synonyms:- 2-Propenoic acid, 3-(methylthio)-, 3′-(acetyloxy)decahydro-7′,7′a-dimethyl-4-methylene-2-oxospiro[furan-3(2H),2′-[2H]inden]-4′-yl ester, [2′R-[2′α,3′α,3′aα,4′β(Z),7′α,7′aα]]-
- Acrylic acid, 3-(methylthio)-, 7′-ester with 3′a,4,4′,5,5′,6′,7′,7′aβ-octahydro-1′β,7′α-dihydroxy-3′aβ,4′β-dimethyl-4-methylenespiro[furan-3(2H),2′-indan]-2-one acetate, (Z)-
- Spiro[furan-3(2H),2′-indan]-2-one, 3′a,4,4′,5,5′,6,7,7′aβ-octahydro-1′β,7′α-dihydroxy-3′aβ,4′β-dimethyl-4-methylene-, 1′-acetate 3-(methylthio)acrylate, (Z)-
- Bakkenolide D
- 2-Propenoic acid, 3-(methylthio)-, (2′R,3′R,3′aR,4′S,7′S,7′aR)-3′-(acetyloxy)decahydro-7′,7′a-dimethyl-4-methylene-2-oxospiro[furan-3(2H),2′-[2H]inden]-4′-yl ester, (2Z)-
Sort by
Found 3 products.
Bakkenolide D
CAS:Bakkenolide D is a sesquiterpene lactone, which is a bioactive compound isolated from the plant Petasites japonicus, commonly known as Japanese butterbur. It functions through various modes of action, primarily by modulating inflammatory pathways in biological systems. Research indicates that Bakkenolide D inhibits the activation of nuclear factor-kappa B (NF-κB), a transcription factor that plays a critical role in regulating immune responses and inflammation. By suppressing NF-κB, Bakkenolide D can reduce the expression of pro-inflammatory cytokines and other mediators, leading to its potential anti-inflammatory effects. The primary uses and applications of Bakkenolide D are in the field of medicinal research, where it is being studied for its potential therapeutic benefits, particularly for conditions characterized by excessive inflammation. These conditions may include chronic inflammatory diseases, arthritis, and other immune-related disorders. Furthermore, its role in decreasing inflammation makes it a subject of interest for developing novel anti-inflammatory drugs. Additionally, ongoing studies are exploring its broader biological effects and possible applications in cancer research, given its influence on cellular signaling pathways.Formula:C21H28O6SPurity:Min. 95%Molecular weight:408.5 g/molBakkenolide D
CAS:Bakkenolide D inhibits histamine-induced trachea contractions, showing anti-allergic properties.Formula:C21H28O6SPurity:98%Color and Shape:SolidMolecular weight:408.51
