
CAS 18711-12-1: 6,7-dichloro-1H-indole-2,3-dione
Formula:C8H3Cl2NO2
InChI:InChI=1/C8H3Cl2NO2/c9-4-2-1-3-6(5(4)10)11-8(13)7(3)12/h1-2H,(H,11,12,13)
SMILES:c1cc(c(c2c1C(=O)C(=O)N2)Cl)Cl
Synonyms:- 1H-indole-2,3-dione, 6,7-dichloro-
Sort by
Found 3 products.
6,7-dichloro-2,3-dihydro-1H-indole-2,3-dione
CAS:6,7-Dichloro-2,3-dihydro-1H-indole-2,3-dione is a drug that is used to treat high blood pressure. It is a potent inhibitor of the enzyme phosphodiesterase (PDE), which breaks down cyclic adenosine monophosphate (cAMP). 6,7-Dichloro-2,3-dihydro-1H-indole-2,3-dione inhibits PDE and increases the concentration of cAMP in cells. This increase in cAMP leads to an increased effect of the neurotransmitter acetylcholine on the heart and blood vessels. 6,7-Dichloro-2,3-dihydro-1H-indole--2,3--dione also increases calcium binding to membrane receptors and increases membrane hyperpolarization. These changes lead to an increase in nω--nitro--Formula:C8H3Cl2NO2Purity:Min. 95%Molecular weight:216.02 g/mol6,7-dichloro-1H-indole-2,3-dione
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:216.02000427246094