
CAS 1878-88-2: 2-(3-Nitrophenoxy)acetic acid
Formula:C8H7NO5
InChI:InChI=1S/C8H7NO5/c10-8(11)5-14-7-3-1-2-6(4-7)9(12)13/h1-4H,5H2,(H,10,11)
InChI key:InChIKey=BNRRQAASFDGMMQ-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=CC(N(=O)=O)=CC=C1
Synonyms:- (3-Nitrophenoxy)Acetate
- 2-(3-Nitrophenoxy)acetic acid
- 3-Nitrophenoxyacetic acid
- Acetic acid, (3-nitrophenoxy)-
- Acetic acid, (m-nitrophenoxy)-
- Acetic acid, 2-(3-nitrophenoxy)-
- NSC 193418
- m-Nitrophenoxyacetic acid
Sort by
Found 4 products.
Acetic acid, 2-(3-nitrophenoxy)-
CAS:Formula:C8H7NO5Purity:98%Color and Shape:SolidMolecular weight:197.14493-Nitrophenoxyaceticacid
CAS:3-Nitrophenoxyaceticacid is a molecule that contains a nitro group and an acid group. It has a molecular weight of 126.2 g/mol and a chemical formula of C6H5NO2O3. 3-Nitrophenoxyaceticacid can be synthesized from phenol, nitric acid, and acetic acid in the presence of iron oxide as a catalyst. The molecule has two functional groups: the nitro group and the carboxylic acid group. 3-Nitrophenoxyaceticacid has been shown to have hydratropic properties due to its ability to form hydrogen bonds with other molecules in water. This molecule also reacts with chlorine in water, forming hydrochloric acid (HCl). 3-Nitrophenoxyaceticacid is insoluble in water but soluble in ethanol and acetone. The molecular weight of this molecule is 126.2 g/mol, which corresponds to its molar mass ofFormula:C8H7NO5Purity:Min. 95%Molecular weight:197.14 g/mol3-Nitrophenoxyacetic Acid
CAS:Formula:C8H7NO5Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:197.15