CAS 18842-99-4: Scandoside
Formula:C16H22O11
InChI:InChI=1S/C16H22O11/c17-2-5-1-7(19)10-6(14(23)24)4-25-15(9(5)10)27-16-13(22)12(21)11(20)8(3-18)26-16/h1,4,7-13,15-22H,2-3H2,(H,23,24)/t7-,8-,9-,10+,11-,12+,13-,15+,16+/m1/s1
InChI key:InChIKey=ZVXWFPTVHBWJOU-AWQYILTISA-N
SMILES:O([C@H]1[C@]2([C@@](C(C(O)=O)=CO1)([C@H](O)C=C2CO)[H])[H])[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O
Synonyms:- Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-7-(hydroxymethyl)-, [1S-(1α,4aα,5α,7aα)]-
- Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-7-(hydroxymethyl)-, (1S,4aS,5R,7aS)-
- Scandoside
- (1S,4aS,5R,7aS)-1-(β-D-Glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-7-(hydroxymethyl)cyclopenta[c]pyran-4-carboxylic acid
Sort by
Found 2 products.
Scandoside
CAS:Scandoside is a bioactive compound, classified as an iridoid glycoside, which is isolated from certain plant species, particularly those belonging to the Apocynaceae and Scrophulariaceae families. This compound is sourced from the leaves and roots of these plants and has attracted scientific interest due to its diverse range of biological activities. The mode of action of Scandoside generally involves interaction with various biochemical pathways, although precise mechanisms can vary depending on the specific biological context. It is known to exhibit antioxidative, anti-inflammatory, and antimicrobial properties, likely owing to its structural configuration and its influence on cellular signaling pathways. Scandoside's diverse pharmacological potential makes it a subject of investigation in the development of therapeutic agents. Its uses can span from research applications in the understanding of plant-derived bioactive compounds to potential roles in medicinal formulations designed to exploit its antioxidative and anti-inflammatory capabilities. Current studies often focus on its efficacy, safety, and mechanism of action to fully comprehend its therapeutic potential.Formula:C16H22O11Purity:Min. 95%Molecular weight:390.34 g/molScandoside
CAS:Scandoside is a cyclic enolide that can be isolated from Haemophilus diffusa and exhibits anti-inflammatory activity.Formula:C16H22O11Purity:98.93%Color and Shape:SolidMolecular weight:390.34
