
CAS 19064-69-8: 1-Phthalazinamine
Formula:C8H7N3
InChI:InChI=1S/C8H7N3/c9-8-7-4-2-1-3-6(7)5-10-11-8/h1-5H,(H2,9,11)
InChI key:InChIKey=WTYSCLHDMXBMKM-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=NN1)C=CC=C2
Synonyms:- 1-Phthalazinamine
- Phthalazin-1-Amine
- Phthalazine, 1-amino-
- 1-Aminophthalazine
Sort by
Found 5 products.
1-Aminophthalazine
CAS:1-Aminophthalazine is a drug that has been used to treat cancer and other diseases. It has the ability to react with nitrogen atoms in the body, which can cause adverse reactions such as psychosis and drug reactions. 1-Aminophthalazine also blocks tyrosine kinases, which are involved in cell growth and differentiation. 1-Aminophthalazine is a reactive compound that can form diazonium salts with an oxidizing agent such as hydrogen peroxide or peracetic acid. The diazonium salt is then able to react with DNA, and is selective for bacterial DNA when it lacks organic material for the diazonium salt to react with. This makes 1-aminophthalazine a specific treatment for bacterial infections.Formula:C8H7N3Purity:Min. 95%Color and Shape:PowderMolecular weight:145.16 g/mol