
CAS 19365-08-3: 3-hydroxypiperidin-2-one
Formula:C5H9NO2
InChI:InChI=1S/C5H9NO2/c7-4-2-1-3-6-5(4)8/h4,7H,1-3H2,(H,6,8)
InChI key:InChIKey=RYKLZUPYJFFNRR-UHFFFAOYSA-N
SMILES:OC1C(=O)NCCC1
Synonyms:- 2-Hydroxyvalerolactam
- 2-Piperidinone, 3-hydroxy-
- 2-Piperidone, 3-hydroxy-
- 3-Hydroxy-2-Piperidinone
- 3-Hydroxy-2-piperidone
- NSC 100722
Sort by
Found 5 products.
3-Hydroxypiperidin-2-one
CAS:Controlled ProductFormula:C5H9NO2Color and Shape:NeatMolecular weight:115.133-Hydroxypiperidin-2-one
CAS:3-Hydroxypiperidin-2-one is a chiral molecule that is composed of two stereoisomers. It has been shown to inhibit the activity of cytochrome P450 2E1, which is involved in the metabolism of some drugs and other xenobiotics. 3-Hydroxypiperidin-2-one also inhibits the growth of tuberculosis bacteria and fungus Aspergillus niger. This compound is a low molecular weight, hydrophobic molecule that can be synthesized from L-glutamic acid and piperidine. The synthesis process involves three steps: 1) condensation with sodium cyanide to form 2,4-dichlorobenzyl alcohol; 2) reaction with hydrogen chloride to form chloroacetyl chloride; 3) reaction with piperidine to form 3-hydroxypiperidin-2-one. This process can be scaled up for industrial production.Formula:C5H9NO2Purity:Min. 95%Molecular weight:115.13 g/molRef: 3D-FH140905
Discontinued product3-Hydroxypiperidin-2-one
CAS:Purity:95.0%Color and Shape:Solid, White powderMolecular weight:115.13200378417969