TRANS-3-(TERT-BUTYLDIMETHYLSILYLOXY)-N, with the CAS number 194233-66-4, is a chemical compound characterized by its unique structural features. It contains a tert-butyldimethylsilyloxy group, which is a protective group commonly used in organic synthesis to enhance the stability and solubility of reactive functional groups. The presence of the trans configuration indicates a specific geometric arrangement around a double bond or a cyclic structure, which can influence the compound's reactivity and physical properties. This compound is typically utilized in synthetic organic chemistry, particularly in the synthesis of more complex molecules, due to its ability to protect hydroxyl groups during reactions. Its molecular structure contributes to its hydrophobic characteristics, making it less soluble in polar solvents while being more soluble in non-polar solvents. Overall, this compound serves as a valuable intermediate in various chemical reactions, particularly in the field of medicinal chemistry and materials science.

TRANS-3-(TERT-BUTYLDIMETHYLSILYLOXY)-N

194233-66-4: 1,3-butadien-1-amine, 3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-N,N-dimethyl-, (1E)-, (1E)-3-{[tert-butyl(dimethyl)silyl]oxy}-N,N-dimethylbuta-1,3-dien-1-amine

Trans-3-(Tert-Butyldimethylsilyloxy)-N,N-Dimethyl-1,3-Butadiene-1-Amine

trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine

Trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine is a synthetic chemical with the chemical formula CH2=C(CH3)2OSi(CH2)2CH2N(CH3)2. It is an asymmetric synthesis of a benzocoumarin that has been shown to have hypoglycemic effects. Trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine is a constant pressure reactant in the homerwadsworthemmons reaction and was used to demonstrate the dehydration mechanism. This compound also has a chloride group and electron deficient carbonyl group that can be used for other reactions. Trans 3-(tertbutyldimethylsilyloxy)-N,Ndimethyl 1,3 butadiene 1

CAS 194233-66-4: TRANS-3-(TERT-BUTYLDIMETHYLSILYLOXY)-N

Trans-3-(Tert-Butyldimethylsilyloxy)-N,N-Dimethyl-1,3-Butadiene-1-Amine

Ref: 54-OR1024531

trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine

Ref: 3B-B5597

trans-3-(tert-Butyldimethylsilyloxy)-N,N-dimethyl-1,3-butadiene-1-amine

Ref: 3D-UHA23366