
CAS 194804-80-3: Methyl 2,4-difluoro-3-hydroxybenzoate
Formula:C8H6F2O3
InChI:InChI=1S/C8H6F2O3/c1-13-8(12)4-2-3-5(9)7(11)6(4)10/h2-3,11H,1H3
InChI key:InChIKey=IASILBBAKSGQJC-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(F)C(O)=C(F)C=C1
Synonyms:- Methyl 2,4-difluoro-3-hydroxybenzoate
- 2,4-Difluoro-3-hydroxybenzoic acid methyl ester
- Benzoic acid, 2,4-difluoro-3-hydroxy-, methyl ester
Sort by
Found 4 products.
2,4-Difluoro-3-hydroxybenzoic acid methyl ester
CAS:2,4-Difluoro-3-hydroxybenzoic acid methyl ester is a fine chemical that is used as a versatile building block for research chemicals and other complex compounds. It can be used as a reaction component in the synthesis of new chemical entities or as a reagent for organic chemistry reactions. 2,4-Difluoro-3-hydroxybenzoic acid methyl ester has CAS No. 194804-80-3 and is available in high quality.Formula:C8H6F2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:188.13 g/mol2,4-difluoro-3-hydroxybenzoic acid methyl ester, 95%
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:188.1300048828125Methyl 2,4-difluoro-3-hydroxybenzoate
CAS:Methyl 2,4-difluoro-3-hydroxybenzoateMolecular weight:188.12825g/mol