
CAS 19484-57-2: 6-chloro-4-hydroxycoumarin
Formula:C9H5ClO3
InChI:InChI=1/C9H5ClO3/c10-5-1-2-8-6(3-5)7(11)4-9(12)13-8/h1-4,11H
SMILES:c1cc2c(cc1Cl)c(cc(=O)o2)O
Synonyms:- 6-chloro-2-hydroxy-4H-chromen-4-one
- 6-chloro-4-hydroxy-2H-chromen-2-one
Sort by
Found 5 products.
6-Chloro-4-hydroxycoumarin
CAS:6-Chloro-4-hydroxycoumarin is a tetronic acid that has been synthesized by the activation of hydroxy groups with palladium complexes. It is a derivative of coumarin and has been shown to be active against Gram-positive bacteria, such as Staphylococcus aureus, and Gram-negative bacteria, such as Escherichia coli. 6-Chloro-4-hydroxycoumarin inhibits bacterial growth by binding to chloride ions in the cell wall and preventing them from being incorporated into the peptidoglycan layer of the cell wall. This drug also binds to metal ions, such as copper or zinc, which are involved in the formation of enzymes and other proteins necessary for cell growth. The stereoisomers of this drug have different activities against bacteria; for example, the (S) stereoisomer is more potent than the (R) stereoisomer.Formula:C9H5ClO3Purity:Min. 95%Molecular weight:196.59 g/mol6-Chloro-4-hydroxy-2H-chromen-2-one
CAS:Formula:C9H5ClO3Purity:97%Color and Shape:SolidMolecular weight:196.58726-Chloro-4-hydroxycoumarin
CAS:Formula:C9H5ClO3Purity:>97.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:196.596-Chloro-4-hydroxycoumarin
CAS:Purity:97.0%Color and Shape:Solid, White powderMolecular weight:196.58999633789062