CAS 195883-06-8: YM 262
Formula:C24H28O9
InChI:InChI=1S/C24H28O9/c1-10(2)22-17(32-22)18-24(33-18)21(3)7-6-11-12(9-29-19(11)28)13(21)8-14-23(24,31-14)20(22)30-16(27)5-4-15(25)26/h10,13-14,17-18,20H,4-9H2,1-3H3,(H,25,26)/t13-,14-,17-,18-,20+,21-,22-,23+,24+/m0/s1
InChI key:InChIKey=HROMYAWHLUOUPY-AHCCQAQQSA-N
SMILES:C[C@@]12[C@@]34[C@]5([C@H](OC(CCC(O)=O)=O)[C@]6([C@H](C)C)[C@]([C@@]3(O4)[H])(O6)[H])[C@@](O5)(C[C@]1(C7=C(CC2)C(=O)OC7)[H])[H]
Synonyms:- Butanedioic acid, 3-(3,4-dichlorophenyl)-2-(ethoxymethyl)-8-methyl-, 1-[(3bS,4aS,5aR,6R,6aS,7aS,7bS,8aS,8bS)-1,3,3b,4,4a,6,6a,7a,7b,8b,9,10-dodecahydro-8b-methyl-6a-(1-methylethyl)-1-oxotrisoxireno[4b,5:6,7:8a,9]phenanthro[1,2-c]furan-6-yl] ester
- Butanedioic acid, mono[(3bS,4aS,5aR,6R,6aS,7aS,7bS,8aS,8bS)-1,3,3b,4,4a,6,6a,7a,7b,8b,9,10-dodecahydro-8b-methyl-6a-(1-methylethyl)-1-oxotrisoxireno[4b,5:6,7:8a,9]phenanthro[1,2-c]furan-6-yl] ester
- Butanedioic acid, mono[1,3,3b,4,4a,6,6a,7a,7b,8b,9,10-dodecahydro-8b-methyl-6a-(1-methylethyl)-1-oxotrisoxireno[4b,5:6,7:8a,9]phenanthro[1,2-c]furan-6-yl] ester, [3bS-(3bα,4aα,5aS*,6β,6aβ,7aβ,7bα,8aR*,8bβ)]-
- Unii-D36Elm729P
- Ym 262
- Omtriptolide
Sort by
Found 2 products.
Omtriptolide
CAS:Omtriptolide is a synthetic derivative of triptolide, which is a diterpenoid epoxide originating from the plant Tripterygium wilfordii, also known as "Thunder God Vine." The compound is engineered to leverage the bioactive properties of triptolide while enhancing its stability and solubility for research and therapeutic purposes. Omtriptolide exerts its effects by inhibiting RNA polymerase II-mediated transcription, leading to the downregulation of anti-apoptotic proteins and thereby inducing apoptosis in cancer cells. It further disrupts the cellular stress response and modulates immune responses, inhibiting tumor growth. The compound holds potential applications primarily in cancer research, serving as a potent anti-tumor agent. Preclinical studies suggest its efficacy across various cancer models, where it demonstrates the ability to overcome drug resistance and potentiate the effects of existing chemotherapeutics. Ongoing research is needed to fully elucidate its pharmacokinetics and therapeutic index, but its unique mode of action positions Omtriptolide as a promising candidate for the development of new oncological therapies.Formula:C24H28O9Purity:Min. 95%Molecular weight:460.47 g/molOmtriptolide
CAS:Omtriptolide, triptolide purified from the Chinese herb, is a water-soluble derivative prodrug.Formula:C24H28O9Purity:98%Color and Shape:SolidMolecular weight:460.479
