
CAS 196194-99-7: 2-Amino-4-nitro-5-methoxybenzoic Acid
Formula:C8H8N2O5
InChI:InChI=1/C8H8N2O5/c1-15-7-2-4(8(11)12)5(9)3-6(7)10(13)14/h2-3H,9H2,1H3,(H,11,12)
SMILES:COc1cc(c(cc1N(=O)=O)N)C(=O)O
Synonyms:- 2-Amino-5-methoxy-4-nitrobenzoic acid
- Benzoic acid, 2-amino-5-methoxy-4-nitro-
Sort by
Found 3 products.
2-Amino-5-methoxy-4-nitrobenzoic acid
CAS:Formula:C8H8N2O5Purity:95%Color and Shape:SolidMolecular weight:212.159520000000042-Amino-4-nitro-5-methoxybenzoic acid
CAS:2-Amino-4-nitro-5-methoxybenzoic acid is a chemical compound that is used in the synthesis of peptide mimetics. The presence of intramolecular hydrogen bonds and the spatial arrangement of the nitro group and methoxy group in this molecule are responsible for its intramolecular nature. When synthesized as a dimer, these two molecules form hydrogen bonds with each other. This chemical can be used to produce oligomers with conformationally restricted side chains by reacting it with an appropriate amine or alcohol.Formula:C8H8N2O5Purity:Min. 95%Molecular weight:212.16 g/molRef: 3D-WHA19499
Discontinued product