
CAS 19914-20-6: enniatin B1
Formula:C34H59N3O9
InChI:InChI=1/C34H59N3O9/c1-16-22(12)25-34(43)46-27(20(8)9)30(39)36(14)23(17(2)3)32(41)44-26(19(6)7)29(38)35(13)24(18(4)5)33(42)45-28(21(10)11)31(40)37(25)15/h17-28H,16H2,1-15H3
SMILES:CCC(C)C1C(=O)OC(C(C)C)C(=O)N(C)C(C(C)C)C(=O)OC(C(C)C)C(=O)N(C)C(C(C)C)C(=O)OC(C(C)C)C(=O)N1C
Synonyms:- 3-(Butan-2-Yl)-4,10,16-Trimethyl-6,9,12,15,18-Penta(Propan-2-Yl)-1,7,13-Trioxa-4,10,16-Triazacyclooctadecane-2,5,8,11,14,17-Hexone
Sort by
Found 7 products.
Enniatin B1
CAS:Enniatin B1, a Fusarium mycotoxin, crosses the blood-brain barrier and modulates ERK, NF-κB, and ACAT with an IC50 of 73 μM.Formula:C34H59N3O9Purity:98%Color and Shape:SolidMolecular weight:653.858Enniatin B1
CAS:Enniatin B1 is a cyclic depsipeptide, which is a type of mycotoxin produced by certain species of Fusarium fungi. It is characterized by its unique structural composition that includes alternating N-methylamino and hydroxy acid residues, forming a cyclic hexadepsipeptide. The source of Enniatin B1 primarily encompasses various Fusarium species, known for their ubiquitous presence in agricultural environments and propensity to contaminate cereal crops. The mode of action of Enniatin B1 involves its ionophoric properties, where it facilitates the transport of monovalent cations, such as potassium and sodium, across biological membranes. This ion transport disrupts cellular ion homeostasis, leading to potential cytotoxic effects in various cell types. Enniatin B1 is mainly used in scientific research, particularly in the study of its biological activities, which include cytotoxic, antimicrobial, and antiproliferative effects. Its ionophoric capability is of interest in examining cellular transport mechanisms and its potential implications in pharmacology and toxicology. Understanding the effects and mechanisms of Enniatin B1 contributes to broader insights into mycotoxin interactions and their impacts on biological systems.Purity:Min. 95%Cyclo[(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-valyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-valyl]
CAS:Formula:C34H59N3O9Purity:98%Color and Shape:SolidMolecular weight:653.8469600000001