![(2E)-3-methyl-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl]p…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F347747-2e-3-methyl-5-1s-2r-4ar-8ar-124a-5-tetramethyl-12344a-788a-octahydronaphthalen-1-yl-pent-2-en-1-ol.webp&w=3840&q=75)
CAS 19941-83-4: (2E)-3-methyl-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl]pent-2-en-1-ol
Formula:C20H34O
InChI:InChI=1/C20H34O/c1-15(11-14-21)9-12-19(4)17(3)10-13-20(5)16(2)7-6-8-18(19)20/h7,11,17-18,21H,6,8-10,12-14H2,1-5H3/b15-11+/t17-,18-,19+,20+/m1/s1
Synonyms:- 2-penten-1-ol, 3-methyl-5-[(1S,2R,4aR,8aR)-1,2,3,4,4a,7,8,8a-octahydro-1,2,4a,5-tetramethyl-1-naphthalenyl]-, (2E)-
Sort by
Found 3 products.
2-Penten-1-ol, 3-methyl-5-[(1S,2R,4aR,8aR)-1,2,3,4,4a,7,8,8a-octahydro-1,2,4a,5-tetramethyl-1-naphthalenyl]-, (2E)-
CAS:Formula:C20H34OPurity:96.5%Color and Shape:SolidMolecular weight:290.48335999999995Kolavenol
CAS:Kolavenol is a diterpenoid compound, which is derived from natural sources, specifically plants from the genus *Coleus*. This diterpenoid is extracted through meticulous processes ensuring the preservation of its active properties. Kolavenol operates by modulating biochemical pathways, potentially influencing inflammatory mediators and specific signaling pathways at the cellular level. Its unique mode of action allows it to interact with target sites, thereby affecting cellular responses. The compound's uses and applications are primarily focused on its potential therapeutic benefits. It is being studied for its anti-inflammatory, antimicrobial, and anticancer properties. Research indicates that Kolavenol may play a role in the development of pharmaceuticals aimed at treating conditions linked to inflammation, microbial infections, and abnormal cell growth. As such, it represents a promising area of investigation for those in the field of medicinal chemistry and pharmacology.Formula:C20H34OPurity:Min. 95%Molecular weight:290.5 g/mol