
CAS 19997-53-6: 2-(bromomethyl)-2,3-dihydrobenzofuran
Formula:C9H9BrO
InChI:InChI=1/C9H9BrO/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-4,8H,5-6H2
SMILES:c1ccc2c(c1)CC(CBr)O2
Synonyms:- 2-(Bromomethyl)-2,3-Dihydro-1-Benzofuran
- 2-Bromomethyl-2,3-dihydrobenzo[b]furan
- 2-Bromomethyl-2,3-dihydrobenzofuran
Sort by
Found 2 products.
2-Bromomethyl-2,3-dihydrobenzofuran
CAS:2-Bromomethyl-2,3-dihydrobenzofuran is a brominating agent that is used to synthesize the corresponding brominated derivative, such as 2-bromo-5-methylphenol. This compound has been shown to be catalytic in the formation of electron densities, which may be due to its intramolecular mechanism. The hypothesized mechanism of this reaction is that it follows an electrophilic substitution process. An ion source was used to detect the presence of this compound and showed no evidence of its ineffectiveness.Formula:C9H9BrOPurity:Min. 95%Molecular weight:213.07 g/molRef: 3D-FB11976
Discontinued product