![10-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[1,2-b]…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F433221-10-6-o-b-d-glucopyranosyl-b-d-glucopyranosyl-oxy-5-hydroxy-8-methoxy-2-methyl-4h-naphtho-12-b-pyran-4-one.webp&w=3840&q=75)
CAS 200127-93-1: 10-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[1,2-b]pyran-4-one
Formula:C27H32O15
InChI:InChI=1S/C27H32O15/c1-9-3-12(29)18-13(30)5-10-4-11(37-2)6-14(17(10)25(18)39-9)40-27-24(36)22(34)20(32)16(42-27)8-38-26-23(35)21(33)19(31)15(7-28)41-26/h3-6,15-16,19-24,26-28,30-36H,7-8H2,1-2H3/t15-,16-,19-,20-,21+,22+,23-,24-,26-,27-/m1/s1
InChI key:InChIKey=CREWSFDYWMXJQL-YCPAWSGYSA-N
SMILES:O(C=1C2=C3C(=C(O)C=C2C=C(OC)C1)C(=O)C=C(C)O3)[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O
Synonyms:- 4H-Naphtho[1,2-b]pyran-4-one, 10-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-
- 10-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[1,2-b]pyran-4-one
- Isorubrofusarin gentiobioside
Sort by
Found 5 products.
Isorubrofusarin-6-O-β-gentiobioside
CAS:Isorubrofusarin-6-O-β-gentiobioside is derived from from Cassia obtusifolia Linn seeds and shows promising inhibitory activity against AChE and BACE1.Formula:C27H32O15Purity:99.69%Color and Shape:SolidMolecular weight:596.53Isorubrofusarin-6-O-β-gentiobioside
CAS:Isorubrofusarin-6-O-β-gentiobiosidePurity:≥98%Molecular weight:596.53g/molIsorubrofusarin-6-o-β-gentiobioside
CAS:Isorubrofusarin-6-o-β-gentiobioside is a natural compound that belongs to the class of naphthopyrone glycosides. This compound is primarily sourced from the fungi of the genus Aspergillus, known for their diverse secondary metabolites. The unique structural configuration, which includes a naphthopyrone core linked to a gentiobioside sugar moiety, enables it to interact effectively with biological membranes and proteins. The mode of action of Isorubrofusarin-6-o-β-gentiobioside is largely associated with its potential antioxidant and antimicrobial properties. By intercalating with cell membranes and interacting with specific proteins, it may inhibit oxidative stress and exhibit antifungal activity. These interactions may lead to perturbations in membrane integrity and cellular processes of pathogenic microbes, resulting in their growth inhibition. In terms of applications, Isorubrofusarin-6-o-β-gentiobioside is primarily studied in the context of biomedical research for its potential role as a natural antimicrobial and antioxidant agent. It is also of interest in phytochemistry and natural product chemistry as a model compound for studying the biosynthesis and bioactivity of fungal secondary metabolites. Further elucidation of its biological activities could contribute to the development of novel therapeutic agents.Formula:C27H32O15Purity:Min. 95%Molecular weight:596.5 g/mol