CAS 20086-06-0: Diosbulbin B
Formula:C19H20O6
InChI:InChI=1S/C19H20O6/c1-18-6-13(9-2-3-22-8-9)25-19(18)7-14(24-17(19)21)15-11-4-10(5-12(15)18)23-16(11)20/h2-3,8,10-15H,4-7H2,1H3
InChI key:InChIKey=QEANLIISUSNNDX-UHFFFAOYSA-N
SMILES:CC12C3(CC(OC3=O)C4C1CC5CC4C(=O)O5)OC(C2)C=6C=COC6
Synonyms:- (2R,3aS,6S,6aS,7R,10R,11aR,11bS)-2-(3-Furanyl)octahydro-11b-methyl-4H-3a,6:7,10-dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione
- 4H-3a,6:7,10-Dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione, 2-(3-furanyl)octahydro-11b-methyl-, (2R,3aS,6S,6aS,7R,10R,11aR,11bS)-
- 4H-3a,6:7,10-Dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione, 2-(3-furanyl)octahydro-11b-methyl-, [2R-(2α,3aβ,6β,6aβ,7β,10β,11aα,11bβ)]-
- Diosbulbin B
Sort by
Found 7 products.
Diosbulbin B
CAS:Diosbulbin B has potential anti-tumor effects which may be related to influencing the immune system for the first time, it also exhibits potential hepatotoxicity.Formula:C19H20O6Purity:95%~99%Molecular weight:344.363Diosbulbin B
CAS:Diosbulbin B is a naturally occurring sesquiterpene lactone, which is derived primarily from the plant Dioscorea bulbifera, commonly known as "air potato" or "bitter yam." As a bioactive compound, Diosbulbin B demonstrates a mode of action that involves the induction of cytotoxicity in malignant cells, primarily through the disruption of microtubule dynamics, leading to cell cycle arrest and apoptosis. This compound has garnered attention in scientific research due to its potential applications in oncology. Diosbulbin B is studied for its ability to inhibit proliferation in various cancer cell lines, presenting a promising therapeutic approach for antitumor drug development. It is also investigated for its synergistic effects when used in combination with other chemotherapeutic agents, offering potential enhancements to current cancer treatment regimens. However, the use of Diosbulbin B requires careful evaluation due to its associated hepatotoxicity and other side effects, necessitating further research to optimize its efficacy and safety profile. The ongoing exploration of its mechanisms and applications underscores its significance in the pursuit of novel anticancer therapies.Formula:C19H20O6Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:344.36 g/molDiosbulbin B
CAS:Diosbulbin B is hepatotoxic and may have anti-tumor properties via immune system modulation.Formula:C19H20O6Purity:98.92% - 99.64%Color and Shape:SolidMolecular weight:344.36
