
CAS 200864-16-0: 6-Nitro-2-tetralone
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c12-10-4-2-7-5-9(11(13)14)3-1-8(7)6-10/h1,3,5H,2,4,6H2
SMILES:c1cc(cc2CCC(=O)Cc12)N(=O)=O
Synonyms:- 6-Nitro-3,4-dihydro-1H-naphthalen-2-one
- 6-nitro-3,4-dihydronaphthalen-2(1H)-one
Sort by
Found 2 products.
6-Nitro-3,4-dihydro-1H-naphthalen-2-one
CAS:6-Nitro-3,4-dihydro-1H-naphthalen-2-one is an anion that has a carbonyl group with the hydroxide ion acting as the conjugate base. The deprotonation of the enolate leads to an equilibrium between the enolate and the protonated form. The transfer of a proton from one molecule to another will cause an imbalance in the concentration of these species. This reaction can be observed by spectroscopy, and is best studied using NMR spectroscopy. The kinetic constants for this reaction are determined by measuring the rate at which it takes place at various temperatures, while thermodynamic constants are obtained by measuring enthalpy changes during the reaction.Formula:C10H9NO3Purity:Min. 95%Molecular weight:191.18 g/molRef: 3D-FN151239
Discontinued product