CAS 20137-14-8: Makisterone A
Formula:C28H46O7
InChI:InChI=1S/C28H46O7/c1-15(24(2,3)33)11-23(32)27(6,34)22-8-10-28(35)17-12-19(29)18-13-20(30)21(31)14-25(18,4)16(17)7-9-26(22,28)5/h12,15-16,18,20-23,30-35H,7-11,13-14H2,1-6H3/t15-,16+,18+,20-,21+,22+,23-,25-,26-,27-,28-/m1/s1
InChI key:InChIKey=IJRBORPEVKCEQD-JMQWOFAPSA-N
SMILES:O[C@]12C=3[C@@]([C@]4(C)[C@](C(=O)C3)(C[C@@H](O)[C@@H](O)C4)[H])(CC[C@]1(C)[C@@]([C@@]([C@@H](C[C@H](C(C)(C)O)C)O)(C)O)(CC2)[H])[H]
Synonyms:- 5β-Ergost-7-en-6-one, 2β,3β,14,20,22,25-hexahydroxy-, (22R)-
- Makisterone A
- Ergost-7-en-6-one, 2,3,14,20,22,25-hexahydroxy-, (2β,3β,5β,22R,24R)-
- (2β,3β,5β,22R,24R)-2,3,14,20,22,25-Hexahydroxyergost-7-en-6-one
- Makisteron A
Sort by
Found 5 products.
Makisterone A
CAS:Controlled ProductMakisterone A is an insect steroid hormone, which is a type of ecdysteroid. It is biosynthesized primarily in the prothoracic glands of insects and plays a crucial role in regulating various physiological processes. The hormone functions by binding to intracellular ecdysone receptors, which then translocate to the cell nucleus, modulating the expression of genes involved in insect development, molting, and metamorphosis. In scientific research, Makisterone A is employed mainly in the study of developmental biology, endocrinology, and insect physiology. By examining its pathways and interactions, researchers gain insights into the molecular mechanisms governing insect growth and adaptation. Understanding its role unfolds opportunities for developing pest control strategies and can also shed light on analogous processes in other species. The knowledge of ecdysteroids like Makisterone A contributes significantly to the field of comparative endocrinology, offering a model for studying hormone action and gene regulation across different organisms.Formula:C28H46O7Purity:Min. 95%Molecular weight:494.66 g/molErgost-7-en-6-one, 2,3,14,20,22,25-hexahydroxy-, (2β,3β,5β,22R,24R)-
CAS:Formula:C28H46O7Purity:98%Molecular weight:494.6606Makisterone A
CAS:Formula:C28H46O7Purity:≥ 95.0%Color and Shape:White to off-white solidMolecular weight:494.7Makisterone A
CAS:Makisterone A is an ecdysteroid that drives molting in insects. It binds the heterodimeric ecdysone receptor with nanomolar affinity.Formula:C28H46O7Color and Shape:SolidMolecular weight:494.66
