CAS 20137-37-5: Rotundic acid
Formula:C30H48O5
InChI:InChI=1S/C30H48O5/c1-18-9-14-30(24(33)34)16-15-27(4)19(23(30)29(18,6)35)7-8-21-25(2)12-11-22(32)26(3,17-31)20(25)10-13-28(21,27)5/h7,18,20-23,31-32,35H,8-17H2,1-6H3,(H,33,34)/t18-,20-,21-,22+,23-,25+,26+,27-,28-,29-,30+/m1/s1
InChI key:InChIKey=YLHQFGOOMKJFLP-LTFXOGOQSA-N
SMILES:C(O)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)([C@@](CO)(C)[C@@H](O)CC5)[H])[H])([C@](C)(O)[C@H](C)CC2)[H]
Synonyms:- Urs-12-en-28-oic acid, 3β,19,23-trihydroxy-
- 3β,19α,23-Trihydroxyurs-12-en-28-oic acid
- (3β,4α)-3,19,23-Trihydroxyurs-12-en-28-oic acid
- Urs-12-en-28-oic acid, 3,19,23-trihydroxy-, (3β,4α)-
- Rotundic acid
Sort by
Found 7 products.
Urs-12-en-28-oic acid, 3,19,23-trihydroxy-, (3β,4α)-
CAS:Formula:C30H48O5Purity:98%Molecular weight:488.6991Rotundic acid
CAS:Controlled ProductRotundic acid is a triterpenoid compound, which is isolated from natural plant sources, such as the Chinese herb *Ilex rotunda*. It is known for its multifaceted biological activities, primarily due to its interaction with cellular signaling pathways. Rotundic acid's mode of action includes modulation of inflammatory cascades and inhibition of specific enzymes involved in the proliferation of cancer cells. This compound interacts with molecular targets such as NF-kB and MAPKs, which play a crucial role in the cellular inflammatory response and the regulation of apoptosis. The applications of rotundic acid are diverse and primarily focused on therapeutic interventions for inflammatory conditions and cancers. Its potential benefits are under investigation in preclinical and clinical studies, highlighting its ability to reduce inflammation and inhibit tumor growth. As research advances, rotundic acid may serve as a valuable lead compound for the development of new anti-inflammatory and anticancer drugs, providing a promising tool in pharmacological and therapeutic research.Formula:C30H48O5Purity:Min. 95%Color and Shape:PowderMolecular weight:488.7 g/molRotundic acid
CAS:Rotundic acid fights various cancers: HepG2, A375, NCI-H446, MCF-7, and HT-29.Formula:C30H48O5Purity:96.91% - 99.97%Color and Shape:SolidMolecular weight:488.7Rotundic acid
CAS:Carboxylic acid with alcohol functionFormula:C30H48O5Purity:≥ 95.0 % (HPLC)Molecular weight:488.7
