
CAS 20139-55-3: 4'-chloro-2'-methylacetoacetanilide
Formula:C11H12ClNO2
InChI:InChI=1S/C11H12ClNO2/c1-7-5-9(12)3-4-10(7)13-11(15)6-8(2)14/h3-5H,6H2,1-2H3,(H,13,15)
InChI key:InChIKey=ODFRAIZRJMUPCP-UHFFFAOYSA-N
SMILES:N(C(CC(C)=O)=O)C1=C(C)C=C(Cl)C=C1
Synonyms:- 4-Chloro-2-Methyl-N-Acetoacet Anilide
- Butanamide, N-(4-chloro-2-methylphenyl)-3-oxo-
- N-(4-chloro-2-methylphenyl)-3-oxobutanamide
- N-Acetoaceto-P-Chloro-O-Toluidide
- NSC 87579
- o-Acetoacetotoluidide, 4′-chloro-
Sort by
Found 4 products.
Butanamide, N-(4-chloro-2-methylphenyl)-3-oxo-
CAS:Formula:C11H12ClNO2Purity:98%Color and Shape:SolidMolecular weight:225.67154'-Chloro-2'-methylacetoacetanilide
CAS:Formula:C11H12ClNO2Purity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:225.674'-Chloro-2'-methylacetoacetanilide
CAS:4'-Chloro-2'-methylacetoacetanilide (4CMA) is a synthetic organic compound that was first synthesized in 1876. It can be used as a yellow dye or as an intermediate for other dyes. 4CMA is also used to produce the red food dye erythrosine, and has been used in the synthesis of azopigments. The use of mass spectrometric techniques to identify 4CMA has allowed it to be detected in environmental samples, such as wastewater and natural water sources. These advances have led to increased interest in the compound's potential toxicity, which has been studied extensively.Formula:C11H12ClNO2Purity:Min. 95%Molecular weight:225.67 g/molRef: 3D-VAA13955
10gTo inquire25gTo inquire50gTo inquire100gTo inquire250gTo inquire250mg198.00€2500mg797.00€