
CAS 20142-87-4: Nitrophenoxyacetylchloride
Formula:C8H6ClNO4
InChI:InChI=1/C8H6ClNO4/c9-8(11)5-14-7-4-2-1-3-6(7)10(12)13/h1-4H,5H2
SMILES:c1ccc(c(c1)N(=O)=O)OCC(=O)Cl
Synonyms:- 2-Nitrophenoxyacetyl chloride
Sort by
Found 3 products.
Acetyl chloride, 2-(2-nitrophenoxy)-
CAS:Formula:C8H6ClNO4Purity:95%Color and Shape:SolidMolecular weight:215.5905(2-Nitrophenoxy)acetyl chloride
CAS:2-Nitrophenoxyacetyl chloride is a centrosymmetric molecule that has hydrogen bonds between the chains. It can exist in two different conformations, depending on the orientations of the nitro groups. In one conformation, the nitro groups are oriented away from each other and in the other conformation, the nitro groups are oriented towards each other. The orientation of these nitro groups determines whether or not there will be intramolecular hydrogen bonding between them. In this molecule, there is also an intramolecular hydrogen bond between the hydroxyl group and one of the nitro groups. This molecule has a chain conformation with a relatively long distance between its hydrogen atoms due to its intramolecular interactions. The dimers form when two chains come together to form a ring-like structure with two hydrogen bonds between them.Formula:C8H6ClNO4Purity:Min. 95%Molecular weight:215.59 g/molRef: 3D-FN121018
Discontinued product