
CAS 20165-38-2: 1,1,2-trifluoro-1,2,2-trinitroethane
Formula:C2F3N3O6
InChI:InChI=1/C2F3N3O6/c3-1(4,6(9)10)2(5,7(11)12)8(13)14
SMILES:C(C(F)(N(=O)=O)N(=O)=O)(F)(F)N(=O)=O
Synonyms:- 1,1,2-Trifluorotrinitroethane
- Ethane, 1,1,2-Trifluoro-1,2,2-Trinitro-
- 1,1,2-Trifluoro-1,2,2-trinitroethane
Sort by
Found 2 products.
1,1,2-Trifluorotrinitroethane
CAS:1,1,2-Trifluorotrinitroethane (TFE) is a fluorinated nitroalkane that can be synthesized by the reaction of dipotassium difluoroacetylnitrate and trinitrofluoroethane. The chemical name for TFE is 1,1,2-trifluoro-2-(trinitromethyl)-1,2-dihydroethane. TFES is a solid at room temperature. The synthesis of TFES involves two steps: first the reaction of dipotassium difluoroacetylnitrate with trinitrofluoroethane to produce 2-diazo-1,3,3-trimethylcyclobutane; then the reaction of 2-diazo-1,3,3-trimethylcyclobutane with potassium fluoride to produce TFES.Formula:C2F3N3O6Purity:Min. 95%Molecular weight:219.03 g/mol