
CAS 20238-83-9: 3-(4-hydroxyphenyl)propanal
Formula:C9H10O2
InChI:InChI=1/C9H10O2/c10-7-1-2-8-3-5-9(11)6-4-8/h3-7,11H,1-2H2
SMILES:C(Cc1ccc(cc1)O)C=O
Sort by
Found 5 products.
Benzenepropanal, 4-hydroxy-
CAS:Formula:C9H10O2Purity:95%Color and Shape:SolidMolecular weight:150.17453-(4-Hydroxyphenyl)propanal
CAS:3-(4-Hydroxyphenyl)propanal is a molecule that is found in the environment and can act as an estrogen. 3-(4-Hydroxyphenyl)propanal has been shown to bind to the estrogen receptor and activate it, which may lead to cancer. The linkages between this molecule and other molecules are currently not well understood, but it has been shown that 3-(4-Hydroxyphenyl)propanal dimerizes in solution. The functional theory of thermodynamics may be used to describe the properties of this molecule. This theory states that "the free energy change in a chemical reaction is equal to the difference between the heat absorbed by the system and the heat lost by it." The theory also states that "a system at equilibrium will have no net entropy change."Formula:C9H10O2Purity:Min. 95%Molecular weight:150.17 g/molRef: 3D-VAA23883
Discontinued product3-(4-Hydroxyphenyl)propanal
CAS:Controlled ProductFormula:C9H10O2Color and Shape:NeatMolecular weight:150.174